C16H21F3N2O5S — CID 58304253
ethyl (3R)-3-(tert-butylsulfinylamino)-2,2-difluoro-3-(2-fluoro-5-nitrophenyl)butanoate (PubChem CID 58304253) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is ethyl (3R)-3-(tert-butylsulfinylamino)-2,2-difluoro-3-(2-fluoro-5-nitrophenyl)butanoate.
| Compound Name | ethyl (3R)-3-(tert-butylsulfinylamino)-2,2-difluoro-3-(2-fluoro-5-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 58304253 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl (3R)-3-(tert-butylsulfinylamino)-2,2-difluoro-3-(2-fluoro-5-nitrophenyl)butanoate |
| SMILES | CCOC(=O)C(F)(F)[C@](C)(NS(=O)C(C)(C)C)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C16H21F3N2O5S/c1-6-26-13(22)16(18,19)15(5,20-27(25)14(2,3)4)11-9-10(21(23)24)7-8-12(11)17/h7-9,20H,6H2,1-5H3/t15-,27?/m1/s1 |
| InChIKey | USFLCBITPATIHE-ZCAHASCXSA-N |
| XLogP | 3.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|