C17H23F3N2O6S — CID 71008988
ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(2-fluoro-4-methoxy-5-nitrophenyl)butanoate (PubChem CID 71008988) has the molecular formula C17H23F3N2O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(2-fluoro-4-methoxy-5-nitrophenyl)butanoate.
| Compound Name | ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(2-fluoro-4-methoxy-5-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 71008988 |
| Molecular Formula | C17H23F3N2O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(2-fluoro-4-methoxy-5-nitrophenyl)butanoate |
| SMILES | CCOC(=O)C(F)(F)[C@](C)(N[S@](=O)C(C)(C)C)c1cc([N+](=O)[O-])c(OC)cc1F |
| InChI | InChI=1S/C17H23F3N2O6S/c1-7-28-14(23)17(19,20)16(5,21-29(26)15(2,3)4)10-8-12(22(24)25)13(27-6)9-11(10)18/h8-9,21H,7H2,1-6H3/t16-,29-/m1/s1 |
| InChIKey | FWHZHMHTVSHAIR-HYDGNGQDSA-N |
| XLogP | 3.21 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|