About 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid
1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid (PubChem CID 162152668) has the molecular formula C12H17FN2O5
and a molecular weight of 288.28 g/mol. Its IUPAC name is 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid.
Molecular Properties
| Compound Name | 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid |
| PubChem CID | 162152668 |
| Molecular Formula | C12H17FN2O5 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1C(C)(C)C.NC(=O)O |
| InChI | InChI=1S/C11H14FNO3.CH3NO2/c1-11(2,3)7-5-9(13(14)15)8(12)6-10(7)16-4;2-1(3)4/h5-6H,1-4H3;2H2,(H,3,4) |
| InChIKey | ZLKNVAJEVDPOBC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid?
The IUPAC name of 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid (CID 162152668) is 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid.
What is the SMILES notation for 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid?
The canonical SMILES for 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid is COc1cc(F)c([N+](=O)[O-])cc1C(C)(C)C.NC(=O)O.
What is the InChIKey of 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid?
The InChIKey is ZLKNVAJEVDPOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO3.CH3NO2/c1-11(2,3)7-5-9(13(14)15)8(12)6-10(7)16-4;2-1(3)4/h5-6H,1-4H3;2H2,(H,3,4).
What are the key properties of 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid?
1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid has a molecular weight of 288.28 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-fluoro-2-methoxy-5-nitrobenzene;carbamic acid is sourced from PubChem (CID 162152668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).