C16H23F2N3O4 — CID 159565656
4-fluoro-2-methoxyaniline;4-fluoro-2-methoxy-5-nitroaniline;methane (PubChem CID 159565656) has the molecular formula C16H23F2N3O4 and a molecular weight of 359.37 g/mol. Its IUPAC name is 4-fluoro-2-methoxyaniline;4-fluoro-2-methoxy-5-nitroaniline;methane.
| Compound Name | 4-fluoro-2-methoxyaniline;4-fluoro-2-methoxy-5-nitroaniline;methane |
|---|---|
| PubChem CID | 159565656 |
| Molecular Formula | C16H23F2N3O4 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-fluoro-2-methoxyaniline;4-fluoro-2-methoxy-5-nitroaniline;methane |
| SMILES | C.C.COc1cc(F)c([N+](=O)[O-])cc1N.COc1cc(F)ccc1N |
| InChI | InChI=1S/C7H7FN2O3.C7H8FNO.2CH4/c1-13-7-2-4(8)6(10(11)12)3-5(7)9;1-10-7-4-5(8)2-3-6(7)9;;/h2-3H,9H2,1H3;2-4H,9H2,1H3;2*1H4 |
| InChIKey | MHDYBIPRYQMVRF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|