C14H19F3N2O4S — CID 67234510
(R)-N-[(2R)-3,3-difluoro-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 67234510) has the molecular formula C14H19F3N2O4S and a molecular weight of 368.38 g/mol. Its IUPAC name is (R)-N-[(2R)-3,3-difluoro-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2R)-3,3-difluoro-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67234510 |
| Molecular Formula | C14H19F3N2O4S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (R)-N-[(2R)-3,3-difluoro-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@](C)(c1cc([N+](=O)[O-])ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C14H19F3N2O4S/c1-12(2,3)24(23)18-13(4,14(16,17)8-20)10-7-9(19(21)22)5-6-11(10)15/h5-7,18,20H,8H2,1-4H3/t13-,24-/m1/s1 |
| InChIKey | QWEZABGDWYBNJE-YEBMWUKDSA-N |
| XLogP | 2.63 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|