C14H19FN4O2S — CID 118672740
2-[S-[(2R)-2-amino-2-(2-fluoro-5-nitrophenyl)propyl]-N-methylsulfinimidoyl]-2-methylpropanenitrile (PubChem CID 118672740) has the molecular formula C14H19FN4O2S and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[S-[(2R)-2-amino-2-(2-fluoro-5-nitrophenyl)propyl]-N-methylsulfinimidoyl]-2-methylpropanenitrile.
| Compound Name | 2-[S-[(2R)-2-amino-2-(2-fluoro-5-nitrophenyl)propyl]-N-methylsulfinimidoyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 118672740 |
| Molecular Formula | C14H19FN4O2S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[S-[(2R)-2-amino-2-(2-fluoro-5-nitrophenyl)propyl]-N-methylsulfinimidoyl]-2-methylpropanenitrile |
| SMILES | C/N=S(/C[C@](C)(N)c1cc([N+](=O)[O-])ccc1F)C(C)(C)C#N |
| InChI | InChI=1S/C14H19FN4O2S/c1-13(2,8-16)22(18-4)9-14(3,17)11-7-10(19(20)21)5-6-12(11)15/h5-7H,9,17H2,1-4H3/t14-,22?/m0/s1 |
| InChIKey | JKJRYVBTUVGZHS-XLEXHMCLSA-N |
| XLogP | 2.64 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|