C17H28FN3O5S2 — CID 173482382
[[(2R)-1-(2-aminobutan-2-ylsulfonyl)-2-(2-fluoro-5-nitrophenyl)propan-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 173482382) has the molecular formula C17H28FN3O5S2 and a molecular weight of 437.56 g/mol. Its IUPAC name is [[(2R)-1-(2-aminobutan-2-ylsulfonyl)-2-(2-fluoro-5-nitrophenyl)propan-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2R)-1-(2-aminobutan-2-ylsulfonyl)-2-(2-fluoro-5-nitrophenyl)propan-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 173482382 |
| Molecular Formula | C17H28FN3O5S2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [[(2R)-1-(2-aminobutan-2-ylsulfonyl)-2-(2-fluoro-5-nitrophenyl)propan-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CCC(C)(N)S(=O)(=O)C[C@](C)(N[S+]([O-])C(C)(C)C)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H28FN3O5S2/c1-7-17(6,19)28(25,26)11-16(5,20-27(24)15(2,3)4)13-10-12(21(22)23)8-9-14(13)18/h8-10,20H,7,11,19H2,1-6H3/t16-,17?,27?/m0/s1 |
| InChIKey | LZQLOVHECLQBDE-PHTBVNCWSA-N |
| XLogP | 2.50 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|