C16H21FN4O4S — CID 118662114
4-[2-amino-2-(2-fluoro-5-nitrophenyl)propyl]sulfonyl-1-methylpiperidine-4-carbonitrile (PubChem CID 118662114) has the molecular formula C16H21FN4O4S and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-[2-amino-2-(2-fluoro-5-nitrophenyl)propyl]sulfonyl-1-methylpiperidine-4-carbonitrile.
| Compound Name | 4-[2-amino-2-(2-fluoro-5-nitrophenyl)propyl]sulfonyl-1-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 118662114 |
| Molecular Formula | C16H21FN4O4S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-[2-amino-2-(2-fluoro-5-nitrophenyl)propyl]sulfonyl-1-methylpiperidine-4-carbonitrile |
| SMILES | CN1CCC(C#N)(S(=O)(=O)CC(C)(N)c2cc([N+](=O)[O-])ccc2F)CC1 |
| InChI | InChI=1S/C16H21FN4O4S/c1-15(19,13-9-12(21(22)23)3-4-14(13)17)11-26(24,25)16(10-18)5-7-20(2)8-6-16/h3-4,9H,5-8,11,19H2,1-2H3 |
| InChIKey | OHNXUGHNSNTDSS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|