C18H26FN3O3S — CID 90047152
2-[(3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)butoxy]-2-methylpropanenitrile (PubChem CID 90047152) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)butoxy]-2-methylpropanenitrile.
| Compound Name | 2-[(3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)butoxy]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 90047152 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[(3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)butoxy]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)OCC[C@](C)(NSC(C)(C)C)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C18H26FN3O3S/c1-16(2,3)26-21-18(6,9-10-25-17(4,5)12-20)14-11-13(22(23)24)7-8-15(14)19/h7-8,11,21H,9-10H2,1-6H3/t18-/m0/s1 |
| InChIKey | MICKMTFQPADTEB-SFHVURJKSA-N |
| XLogP | 4.69 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|