C12H13FN2O3S — CID 86651933
(3S)-3-(2-fluoro-5-nitrophenyl)-3-isothiocyanatopentan-1-ol (PubChem CID 86651933) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is (3S)-3-(2-fluoro-5-nitrophenyl)-3-isothiocyanatopentan-1-ol.
| Compound Name | (3S)-3-(2-fluoro-5-nitrophenyl)-3-isothiocyanatopentan-1-ol |
|---|---|
| PubChem CID | 86651933 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (3S)-3-(2-fluoro-5-nitrophenyl)-3-isothiocyanatopentan-1-ol |
| SMILES | CC[C@@](CCO)(N=C=S)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C12H13FN2O3S/c1-2-12(5-6-16,14-8-19)10-7-9(15(17)18)3-4-11(10)13/h3-4,7,16H,2,5-6H2,1H3/t12-/m0/s1 |
| InChIKey | YGNXHYYMDITPTD-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|