C23H26F2N4O6S — CID 87244001
(6S,8S)-3-amino-3,8-bis(2-fluoro-5-nitrophenyl)-8-isothiocyanatodecane-5,6-diol (PubChem CID 87244001) has the molecular formula C23H26F2N4O6S and a molecular weight of 524.55 g/mol. Its IUPAC name is (6S,8S)-3-amino-3,8-bis(2-fluoro-5-nitrophenyl)-8-isothiocyanatodecane-5,6-diol.
| Compound Name | (6S,8S)-3-amino-3,8-bis(2-fluoro-5-nitrophenyl)-8-isothiocyanatodecane-5,6-diol |
|---|---|
| PubChem CID | 87244001 |
| Molecular Formula | C23H26F2N4O6S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (6S,8S)-3-amino-3,8-bis(2-fluoro-5-nitrophenyl)-8-isothiocyanatodecane-5,6-diol |
| SMILES | CCC(N)(CC(O)[C@@H](O)C[C@](CC)(N=C=S)c1cc([N+](=O)[O-])ccc1F)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C23H26F2N4O6S/c1-3-22(26,16-9-14(28(32)33)5-7-18(16)24)11-20(30)21(31)12-23(4-2,27-13-36)17-10-15(29(34)35)6-8-19(17)25/h5-10,20-21,30-31H,3-4,11-12,26H2,1-2H3/t20?,21-,22?,23-/m0/s1 |
| InChIKey | DLDPVWSASWCCCX-ZWDXQAFOSA-N |
| XLogP | 4.26 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|