C22H26FN3O3S — CID 90047154
2-[(1S,3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)-1-phenylbutoxy]acetonitrile (PubChem CID 90047154) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[(1S,3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)-1-phenylbutoxy]acetonitrile.
| Compound Name | 2-[(1S,3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)-1-phenylbutoxy]acetonitrile |
|---|---|
| PubChem CID | 90047154 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[(1S,3S)-3-(tert-butylsulfanylamino)-3-(2-fluoro-5-nitrophenyl)-1-phenylbutoxy]acetonitrile |
| SMILES | CC(C)(C)SN[C@@](C)(C[C@H](OCC#N)c1ccccc1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C22H26FN3O3S/c1-21(2,3)30-25-22(4,18-14-17(26(27)28)10-11-19(18)23)15-20(29-13-12-24)16-8-6-5-7-9-16/h5-11,14,20,25H,13,15H2,1-4H3/t20-,22-/m0/s1 |
| InChIKey | FTDSDYGCDBEPAJ-UNMCSNQZSA-N |
| XLogP | 5.66 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|