C15H20N4O6 — CID 122528339
tert-butyl 4-[2-[(4-nitrophenyl)carbamoyl]hydrazinyl]-4-oxobutanoate (PubChem CID 122528339) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-nitrophenyl)carbamoyl]hydrazinyl]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[2-[(4-nitrophenyl)carbamoyl]hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 122528339 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | tert-butyl 4-[2-[(4-nitrophenyl)carbamoyl]hydrazinyl]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)NNC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N4O6/c1-15(2,3)25-13(21)9-8-12(20)17-18-14(22)16-10-4-6-11(7-5-10)19(23)24/h4-7H,8-9H2,1-3H3,(H,17,20)(H2,16,18,22) |
| InChIKey | URRYEKLEDGZBNP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|