C13H19N3O4 — CID 103916786
1-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-(4-nitrophenyl)urea (PubChem CID 103916786) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-(4-nitrophenyl)urea.
| Compound Name | 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 103916786 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-(4-nitrophenyl)urea |
| SMILES | CC(C)(O)C(C)(C)NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19N3O4/c1-12(2,13(3,4)18)15-11(17)14-9-5-7-10(8-6-9)16(19)20/h5-8,18H,1-4H3,(H2,14,15,17) |
| InChIKey | JOYSVYWDWUPLFT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|