C12H11F2N3O3 — CID 86674107
[(1R)-1-(1,1-difluoro-2-hydroxyethyl)-6-nitro-2,3-dihydroinden-1-yl]cyanamide (PubChem CID 86674107) has the molecular formula C12H11F2N3O3 and a molecular weight of 283.23 g/mol. Its IUPAC name is [(1R)-1-(1,1-difluoro-2-hydroxyethyl)-6-nitro-2,3-dihydroinden-1-yl]cyanamide.
| Compound Name | [(1R)-1-(1,1-difluoro-2-hydroxyethyl)-6-nitro-2,3-dihydroinden-1-yl]cyanamide |
|---|---|
| PubChem CID | 86674107 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [(1R)-1-(1,1-difluoro-2-hydroxyethyl)-6-nitro-2,3-dihydroinden-1-yl]cyanamide |
| SMILES | N#CN[C@]1(C(F)(F)CO)CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H11F2N3O3/c13-12(14,6-18)11(16-7-15)4-3-8-1-2-9(17(19)20)5-10(8)11/h1-2,5,16,18H,3-4,6H2/t11-/m1/s1 |
| InChIKey | BMFNIABNNFOECN-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|