C19H17FN2O5 — CID 46930693
ethyl (4R,5R)-4-(2-fluoro-4-nitrophenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 46930693) has the molecular formula C19H17FN2O5 and a molecular weight of 372.35 g/mol. Its IUPAC name is ethyl (4R,5R)-4-(2-fluoro-4-nitrophenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl (4R,5R)-4-(2-fluoro-4-nitrophenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 46930693 |
| Molecular Formula | C19H17FN2O5 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl (4R,5R)-4-(2-fluoro-4-nitrophenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccc([N+](=O)[O-])cc2F)N=C(c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C19H17FN2O5/c1-3-26-18(23)19(15-10-9-14(22(24)25)11-16(15)20)12(2)27-17(21-19)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3/t12-,19+/m1/s1 |
| InChIKey | LTESKVBCVAVQLT-BLVKFPJESA-N |
| XLogP | 3.36 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|