C27H22N2O4S — CID 10695692
ethyl 4-[(4-nitrophenyl)sulfanylamino]-3,5-diphenylbenzoate (PubChem CID 10695692) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is ethyl 4-[(4-nitrophenyl)sulfanylamino]-3,5-diphenylbenzoate.
| Compound Name | ethyl 4-[(4-nitrophenyl)sulfanylamino]-3,5-diphenylbenzoate |
|---|---|
| PubChem CID | 10695692 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | ethyl 4-[(4-nitrophenyl)sulfanylamino]-3,5-diphenylbenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)c(NSc2ccc([N+](=O)[O-])cc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H22N2O4S/c1-2-33-27(30)21-17-24(19-9-5-3-6-10-19)26(25(18-21)20-11-7-4-8-12-20)28-34-23-15-13-22(14-16-23)29(31)32/h3-18,28H,2H2,1H3 |
| InChIKey | YVAIWPHGFKFWML-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|