About 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine
4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine (PubChem CID 59443043) has the molecular formula C10H9ClN2O3
and a molecular weight of 240.65 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine |
| PubChem CID | 59443043 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine |
| SMILES | CC1(C)N=C(Cl)c2ccc([N+](=O)[O-])cc2O1 |
| InChI | InChI=1S/C10H9ClN2O3/c1-10(2)12-9(11)7-4-3-6(13(14)15)5-8(7)16-10/h3-5H,1-2H3 |
| InChIKey | SFRHFCQPMFQCNR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine?
The IUPAC name of 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine (CID 59443043) is 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine.
What is the SMILES notation for 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine?
The canonical SMILES for 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine is CC1(C)N=C(Cl)c2ccc([N+](=O)[O-])cc2O1.
What is the InChIKey of 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine?
The InChIKey is SFRHFCQPMFQCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O3/c1-10(2)12-9(11)7-4-3-6(13(14)15)5-8(7)16-10/h3-5H,1-2H3.
What are the key properties of 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine?
4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine has a molecular weight of 240.65 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,2-dimethyl-7-nitro-1,3-benzoxazine is sourced from PubChem (CID 59443043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).