C20H17F3N2O7S — CID 19788111
2-[3-hydroxy-2,2-dimethyl-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-4-yl]-6-nitro-3H-isoindol-1-one (PubChem CID 19788111) has the molecular formula C20H17F3N2O7S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2-[3-hydroxy-2,2-dimethyl-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-4-yl]-6-nitro-3H-isoindol-1-one.
| Compound Name | 2-[3-hydroxy-2,2-dimethyl-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-4-yl]-6-nitro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 19788111 |
| Molecular Formula | C20H17F3N2O7S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[3-hydroxy-2,2-dimethyl-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-4-yl]-6-nitro-3H-isoindol-1-one |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)C(F)(F)F)cc2C(N2Cc3ccc([N+](=O)[O-])cc3C2=O)C1O |
| InChI | InChI=1S/C20H17F3N2O7S/c1-19(2)17(26)16(24-9-10-3-4-11(25(28)29)7-13(10)18(24)27)14-8-12(5-6-15(14)32-19)33(30,31)20(21,22)23/h3-8,16-17,26H,9H2,1-2H3 |
| InChIKey | RPSTWJNGSQCRAV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|