C22H18F7NO5S — CID 57307290
2-[(3R,4S)-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3H-isoindol-1-one (PubChem CID 57307290) has the molecular formula C22H18F7NO5S and a molecular weight of 541.44 g/mol. Its IUPAC name is 2-[(3R,4S)-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3H-isoindol-1-one.
| Compound Name | 2-[(3R,4S)-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 57307290 |
| Molecular Formula | C22H18F7NO5S |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | 2-[(3R,4S)-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3H-isoindol-1-one |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2[C@H](N2Cc3ccccc3C2=O)[C@H]1O |
| InChI | InChI=1S/C22H18F7NO5S/c1-19(2)17(31)16(30-10-11-5-3-4-6-13(11)18(30)32)14-9-12(7-8-15(14)35-19)36(33,34)22(28,29)20(23,24)21(25,26)27/h3-9,16-17,31H,10H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | RGMZBRQRDQUGKS-DLBZAZTESA-N |
| XLogP | 4.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|