C20H20BrNO5S — CID 139980005
[(3S,4R)-6-bromo-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-3,4-dihydrochromen-3-yl] methanesulfonate (PubChem CID 139980005) has the molecular formula C20H20BrNO5S and a molecular weight of 466.35 g/mol. Its IUPAC name is [(3S,4R)-6-bromo-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-3,4-dihydrochromen-3-yl] methanesulfonate.
| Compound Name | [(3S,4R)-6-bromo-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-3,4-dihydrochromen-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 139980005 |
| Molecular Formula | C20H20BrNO5S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | [(3S,4R)-6-bromo-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-3,4-dihydrochromen-3-yl] methanesulfonate |
| SMILES | CC1(C)Oc2ccc(Br)cc2[C@@H](N2Cc3ccccc3C2=O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C20H20BrNO5S/c1-20(2)18(27-28(3,24)25)17(15-10-13(21)8-9-16(15)26-20)22-11-12-6-4-5-7-14(12)19(22)23/h4-10,17-18H,11H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | LAKJTNDSKBYVEJ-MSOLQXFVSA-N |
| XLogP | 3.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|