C17H23ClN2O4S — CID 139979988
[(3S,4R)-6-chloro-2,2-dimethyl-4-(2-methyliminopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] methanesulfonate (PubChem CID 139979988) has the molecular formula C17H23ClN2O4S and a molecular weight of 386.90 g/mol. Its IUPAC name is [(3S,4R)-6-chloro-2,2-dimethyl-4-(2-methyliminopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] methanesulfonate.
| Compound Name | [(3S,4R)-6-chloro-2,2-dimethyl-4-(2-methyliminopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 139979988 |
| Molecular Formula | C17H23ClN2O4S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(3S,4R)-6-chloro-2,2-dimethyl-4-(2-methyliminopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] methanesulfonate |
| SMILES | C/N=C1\CCCN1[C@@H]1c2cc(Cl)ccc2OC(C)(C)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C17H23ClN2O4S/c1-17(2)16(24-25(4,21)22)15(20-9-5-6-14(20)19-3)12-10-11(18)7-8-13(12)23-17/h7-8,10,15-16H,5-6,9H2,1-4H3/b19-14+/t15-,16+/m1/s1 |
| InChIKey | VRRMKTPTCRQCKY-AKOCJZKKSA-N |
| XLogP | 3.02 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|