C24H39BrN2O6SSi — CID 139979961
[(3S,4R)-6-bromo-4-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxopiperazin-1-yl]-2,2-dimethyl-3,4-dihydrochromen-3-yl] methanesulfonate (PubChem CID 139979961) has the molecular formula C24H39BrN2O6SSi and a molecular weight of 591.64 g/mol. Its IUPAC name is [(3S,4R)-6-bromo-4-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxopiperazin-1-yl]-2,2-dimethyl-3,4-dihydrochromen-3-yl] methanesulfonate.
| Compound Name | [(3S,4R)-6-bromo-4-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxopiperazin-1-yl]-2,2-dimethyl-3,4-dihydrochromen-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 139979961 |
| Molecular Formula | C24H39BrN2O6SSi |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | [(3S,4R)-6-bromo-4-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxopiperazin-1-yl]-2,2-dimethyl-3,4-dihydrochromen-3-yl] methanesulfonate |
| SMILES | CC1(C)Oc2ccc(Br)cc2[C@@H](N2CCN(CCO[Si](C)(C)C(C)(C)C)CC2=O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C24H39BrN2O6SSi/c1-23(2,3)35(7,8)31-14-13-26-11-12-27(20(28)16-26)21-18-15-17(25)9-10-19(18)32-24(4,5)22(21)33-34(6,29)30/h9-10,15,21-22H,11-14,16H2,1-8H3/t21-,22+/m1/s1 |
| InChIKey | LIWLMFJYFDLUPD-YADHBBJMSA-N |
| XLogP | 4.17 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|