C18H23N2O7P — CID 166057795
2-[[(3R,4R)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl]oxy]ethyl dihydrogen phosphate (PubChem CID 166057795) has the molecular formula C18H23N2O7P and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-[[(3R,4R)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl]oxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[[(3R,4R)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl]oxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166057795 |
| Molecular Formula | C18H23N2O7P |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[(3R,4R)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl]oxy]ethyl dihydrogen phosphate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](N2CCCC2=O)[C@H]1OCCOP(=O)(O)O |
| InChI | InChI=1S/C18H23N2O7P/c1-18(2)17(25-8-9-26-28(22,23)24)16(20-7-3-4-15(20)21)13-10-12(11-19)5-6-14(13)27-18/h5-6,10,16-17H,3-4,7-9H2,1-2H3,(H2,22,23,24)/t16-,17-/m1/s1 |
| InChIKey | CDHIGEOPGAHQMC-IAGOWNOFSA-N |
| XLogP | 1.89 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|