C23H32N2O4 — CID 165387289
1-[(3S,4R)-3-(7-hydroxyheptoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one (PubChem CID 165387289) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(7-hydroxyheptoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S,4R)-3-(7-hydroxyheptoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 165387289 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[(3S,4R)-3-(7-hydroxyheptoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](N1CCCC1=O)[C@H](OCCCCCCCO)C(C)(C)O2 |
| InChI | InChI=1S/C23H32N2O4/c1-23(2)22(28-15-8-6-4-5-7-14-26)21(25-13-9-10-20(25)27)18-16-17(24-3)11-12-19(18)29-23/h11-12,16,21-22,26H,4-10,13-15H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | PSTFZCUWGVJOJF-YADHBBJMSA-N |
| XLogP | 4.40 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|