C16H19N2O6P — CID 140762138
[(3S,4R)-6-isocyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] dihydrogen phosphate (PubChem CID 140762138) has the molecular formula C16H19N2O6P and a molecular weight of 366.31 g/mol. Its IUPAC name is [(3S,4R)-6-isocyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] dihydrogen phosphate.
| Compound Name | [(3S,4R)-6-isocyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 140762138 |
| Molecular Formula | C16H19N2O6P |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(3S,4R)-6-isocyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] dihydrogen phosphate |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](N1CCCC1=O)[C@H](OP(=O)(O)O)C(C)(C)O2 |
| InChI | InChI=1S/C16H19N2O6P/c1-16(2)15(24-25(20,21)22)14(18-8-4-5-13(18)19)11-9-10(17-3)6-7-12(11)23-16/h6-7,9,14-15H,4-5,8H2,1-2H3,(H2,20,21,22)/t14-,15+/m1/s1 |
| InChIKey | SWUCZITVAZRHIV-CABCVRRESA-N |
| XLogP | 2.55 |
| TPSA | 100.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|