C22H30N2O4 — CID 165387350
1-[(3S,4R)-3-(6-hydroxyhexoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one (PubChem CID 165387350) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(6-hydroxyhexoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S,4R)-3-(6-hydroxyhexoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 165387350 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[(3S,4R)-3-(6-hydroxyhexoxy)-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](N1CCCC1=O)[C@H](OCCCCCCO)C(C)(C)O2 |
| InChI | InChI=1S/C22H30N2O4/c1-22(2)21(27-14-7-5-4-6-13-25)20(24-12-8-9-19(24)26)17-15-16(23-3)10-11-18(17)28-22/h10-11,15,20-21,25H,4-9,12-14H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | NPFQPAYUTIBQSC-RTWAWAEBSA-N |
| XLogP | 4.01 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|