C21H21N3O3S — CID 99736885
(1S,9S,10S)-6-nitro-16-phenyl-2-oxa-16,18-diazatetracyclo[7.6.3.01,10.03,8]octadeca-3(8),4,6-triene-17-thione (PubChem CID 99736885) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (1S,9S,10S)-6-nitro-16-phenyl-2-oxa-16,18-diazatetracyclo[7.6.3.01,10.03,8]octadeca-3(8),4,6-triene-17-thione.
| Compound Name | (1S,9S,10S)-6-nitro-16-phenyl-2-oxa-16,18-diazatetracyclo[7.6.3.01,10.03,8]octadeca-3(8),4,6-triene-17-thione |
|---|---|
| PubChem CID | 99736885 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (1S,9S,10S)-6-nitro-16-phenyl-2-oxa-16,18-diazatetracyclo[7.6.3.01,10.03,8]octadeca-3(8),4,6-triene-17-thione |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@H]1NC(=S)N(c3ccccc3)[C@@]3(CCCCC[C@@H]13)O2 |
| InChI | InChI=1S/C21H21N3O3S/c25-24(26)15-10-11-18-16(13-15)19-17-9-5-2-6-12-21(17,27-18)23(20(28)22-19)14-7-3-1-4-8-14/h1,3-4,7-8,10-11,13,17,19H,2,5-6,9,12H2,(H,22,28)/t17-,19+,21-/m0/s1 |
| InChIKey | DGWUBGIHXCKJOO-DSKINZAPSA-N |
| XLogP | 4.70 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|