C19H21N3O4 — CID 54467903
1-benzyl-1-[(1R,2R)-2-hydroxy-3,3-dimethyl-6-nitro-1,2-dihydroinden-1-yl]urea (PubChem CID 54467903) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-benzyl-1-[(1R,2R)-2-hydroxy-3,3-dimethyl-6-nitro-1,2-dihydroinden-1-yl]urea.
| Compound Name | 1-benzyl-1-[(1R,2R)-2-hydroxy-3,3-dimethyl-6-nitro-1,2-dihydroinden-1-yl]urea |
|---|---|
| PubChem CID | 54467903 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-benzyl-1-[(1R,2R)-2-hydroxy-3,3-dimethyl-6-nitro-1,2-dihydroinden-1-yl]urea |
| SMILES | CC1(C)c2ccc([N+](=O)[O-])cc2[C@@H](N(Cc2ccccc2)C(N)=O)[C@@H]1O |
| InChI | InChI=1S/C19H21N3O4/c1-19(2)15-9-8-13(22(25)26)10-14(15)16(17(19)23)21(18(20)24)11-12-6-4-3-5-7-12/h3-10,16-17,23H,11H2,1-2H3,(H2,20,24)/t16-,17+/m1/s1 |
| InChIKey | XGGIWGMOWQDCPC-SJORKVTESA-N |
| XLogP | 2.87 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|