C24H30N2O6 — CID 142686566
[(3R,4S)-4-tert-butyl-3-hydroxy-2,2-dimethyl-7-nitro-3-(2-phenylethyl)chromen-4-yl] carbamate (PubChem CID 142686566) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [(3R,4S)-4-tert-butyl-3-hydroxy-2,2-dimethyl-7-nitro-3-(2-phenylethyl)chromen-4-yl] carbamate.
| Compound Name | [(3R,4S)-4-tert-butyl-3-hydroxy-2,2-dimethyl-7-nitro-3-(2-phenylethyl)chromen-4-yl] carbamate |
|---|---|
| PubChem CID | 142686566 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(3R,4S)-4-tert-butyl-3-hydroxy-2,2-dimethyl-7-nitro-3-(2-phenylethyl)chromen-4-yl] carbamate |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])ccc2[C@@](OC(N)=O)(C(C)(C)C)[C@@]1(O)CCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O6/c1-21(2,3)24(32-20(25)27)18-12-11-17(26(29)30)15-19(18)31-22(4,5)23(24,28)14-13-16-9-7-6-8-10-16/h6-12,15,28H,13-14H2,1-5H3,(H2,25,27)/t23-,24-/m1/s1 |
| InChIKey | FZFDOPPTCFUPRX-DNQXCXABSA-N |
| XLogP | 4.47 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|