C23H29N3O4S — CID 87874193
[1-[carbamothioyl-[(1S)-1-(4-nitrophenyl)ethyl]amino]-3-phenylpropyl] 2,2-dimethylpropanoate (PubChem CID 87874193) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is [1-[carbamothioyl-[(1S)-1-(4-nitrophenyl)ethyl]amino]-3-phenylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [1-[carbamothioyl-[(1S)-1-(4-nitrophenyl)ethyl]amino]-3-phenylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87874193 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [1-[carbamothioyl-[(1S)-1-(4-nitrophenyl)ethyl]amino]-3-phenylpropyl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H](c1ccc([N+](=O)[O-])cc1)N(C(N)=S)C(CCc1ccccc1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H29N3O4S/c1-16(18-11-13-19(14-12-18)26(28)29)25(22(24)31)20(30-21(27)23(2,3)4)15-10-17-8-6-5-7-9-17/h5-9,11-14,16,20H,10,15H2,1-4H3,(H2,24,31)/t16-,20?/m0/s1 |
| InChIKey | OSZPDRJUHYUBSO-DJZRFWRSSA-N |
| XLogP | 4.75 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|