C20H24N2O4 — CID 174676558
[3-benzyl-2-methyl-5-(4-nitrophenyl)pentan-2-yl] carbamate (PubChem CID 174676558) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [3-benzyl-2-methyl-5-(4-nitrophenyl)pentan-2-yl] carbamate.
| Compound Name | [3-benzyl-2-methyl-5-(4-nitrophenyl)pentan-2-yl] carbamate |
|---|---|
| PubChem CID | 174676558 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [3-benzyl-2-methyl-5-(4-nitrophenyl)pentan-2-yl] carbamate |
| SMILES | CC(C)(OC(N)=O)C(CCc1ccc([N+](=O)[O-])cc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-20(2,26-19(21)23)17(14-16-6-4-3-5-7-16)11-8-15-9-12-18(13-10-15)22(24)25/h3-7,9-10,12-13,17H,8,11,14H2,1-2H3,(H2,21,23) |
| InChIKey | LQZHVXXTGRQBAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|