C19H29N3O2 — CID 68624835
3-(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-piperidin-4-ylbutan-1-amine (PubChem CID 68624835) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-piperidin-4-ylbutan-1-amine.
| Compound Name | 3-(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-piperidin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 68624835 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-piperidin-4-ylbutan-1-amine |
| SMILES | CC(CCN)(C1CCNCC1)C1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C19H29N3O2/c1-19(8-9-20,16-6-10-21-11-7-16)17-4-2-14-3-5-18(22(23)24)13-15(14)12-17/h3,5,13,16-17,21H,2,4,6-12,20H2,1H3 |
| InChIKey | BXHNNOBITDFCDE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|