C16H22N2O2 — CID 174733912
2,2-dimethyl-1-(5-nitro-2,3-dihydro-1H-inden-2-yl)piperidine (PubChem CID 174733912) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(5-nitro-2,3-dihydro-1H-inden-2-yl)piperidine.
| Compound Name | 2,2-dimethyl-1-(5-nitro-2,3-dihydro-1H-inden-2-yl)piperidine |
|---|---|
| PubChem CID | 174733912 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2,2-dimethyl-1-(5-nitro-2,3-dihydro-1H-inden-2-yl)piperidine |
| SMILES | CC1(C)CCCCN1C1Cc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2)7-3-4-8-17(16)15-9-12-5-6-14(18(19)20)10-13(12)11-15/h5-6,10,15H,3-4,7-9,11H2,1-2H3 |
| InChIKey | IPWZSOLTSVZYIL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|