C20H22N2O2 — CID 45277286
1-(13-nitro-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)piperidine (PubChem CID 45277286) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(13-nitro-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)piperidine.
| Compound Name | 1-(13-nitro-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)piperidine |
|---|---|
| PubChem CID | 45277286 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(13-nitro-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)piperidine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCCc1cc(N3CCCCC3)ccc1-2 |
| InChI | InChI=1S/C20H22N2O2/c23-22(24)18-8-10-20-16(14-18)6-4-5-15-13-17(7-9-19(15)20)21-11-2-1-3-12-21/h7-10,13-14H,1-6,11-12H2 |
| InChIKey | XPEXEJVCPSHRRL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|