C9H9N2O3P — CID 58851470
6-nitro-2-phosphanyl-3,4-dihydroisoquinolin-1-one (PubChem CID 58851470) has the molecular formula C9H9N2O3P and a molecular weight of 224.16 g/mol. Its IUPAC name is 6-nitro-2-phosphanyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-nitro-2-phosphanyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 58851470 |
| Molecular Formula | C9H9N2O3P |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 6-nitro-2-phosphanyl-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2CCN1P |
| InChI | InChI=1S/C9H9N2O3P/c12-9-8-2-1-7(11(13)14)5-6(8)3-4-10(9)15/h1-2,5H,3-4,15H2 |
| InChIKey | KWVXBESPNXZBQJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|