C11H12N2O4 — CID 121378947
4-ethyl-9-nitro-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 121378947) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-ethyl-9-nitro-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-ethyl-9-nitro-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 121378947 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-ethyl-9-nitro-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CCN1CCOc2c(cccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C11H12N2O4/c1-2-12-6-7-17-10-8(11(12)14)4-3-5-9(10)13(15)16/h3-5H,2,6-7H2,1H3 |
| InChIKey | FRIKKXYPBPQCJJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|