About 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine
2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine (PubChem CID 74558917) has the molecular formula C10H11N5O3
and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine.
Molecular Properties
| Compound Name | 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine |
| PubChem CID | 74558917 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine |
| SMILES | NC(N)=NN=C1CCOc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O3/c11-10(12)14-13-7-4-5-18-9-6(7)2-1-3-8(9)15(16)17/h1-3H,4-5H2,(H4,11,12,14) |
| InChIKey | BRIBJEJLGGFGPM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine?
The IUPAC name of 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine (CID 74558917) is 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine.
What is the SMILES notation for 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine?
The canonical SMILES for 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine is NC(N)=NN=C1CCOc2c1cccc2[N+](=O)[O-].
What is the InChIKey of 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine?
The InChIKey is BRIBJEJLGGFGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O3/c11-10(12)14-13-7-4-5-18-9-6(7)2-1-3-8(9)15(16)17/h1-3H,4-5H2,(H4,11,12,14).
What are the key properties of 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine?
2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine has a molecular weight of 249.23 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-nitro-2,3-dihydrochromen-4-ylidene)amino]guanidine is sourced from PubChem (CID 74558917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).