C12H11N3O3 — CID 139581218
1-methyl-8-nitro-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepine (PubChem CID 139581218) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-methyl-8-nitro-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepine.
| Compound Name | 1-methyl-8-nitro-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepine |
|---|---|
| PubChem CID | 139581218 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-methyl-8-nitro-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepine |
| SMILES | Cc1ncn2c1-c1cccc([N+](=O)[O-])c1OCC2 |
| InChI | InChI=1S/C12H11N3O3/c1-8-11-9-3-2-4-10(15(16)17)12(9)18-6-5-14(11)7-13-8/h2-4,7H,5-6H2,1H3 |
| InChIKey | AHVSNUONXROZCM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|