About 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole
7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole (PubChem CID 122678097) has the molecular formula C5H5N3O3
and a molecular weight of 155.11 g/mol. Its IUPAC name is 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole.
Molecular Properties
| Compound Name | 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
| PubChem CID | 122678097 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
| SMILES | O=[N+]([O-])c1cnn2c1OCC2 |
| InChI | InChI=1S/C5H5N3O3/c9-8(10)4-3-6-7-1-2-11-5(4)7/h3H,1-2H2 |
| InChIKey | LHSYJDASXCGFHY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The IUPAC name of 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole (CID 122678097) is 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole.
What is the SMILES notation for 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The canonical SMILES for 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole is O=[N+]([O-])c1cnn2c1OCC2.
What is the InChIKey of 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The InChIKey is LHSYJDASXCGFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O3/c9-8(10)4-3-6-7-1-2-11-5(4)7/h3H,1-2H2.
What are the key properties of 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole has a molecular weight of 155.11 g/mol, XLogP of 0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-2,3-dihydropyrazolo[5,1-b][1,3]oxazole is sourced from PubChem (CID 122678097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).