C7H8N4O3 — CID 135241053
5-methyl-3-nitro-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 135241053) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is 5-methyl-3-nitro-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-methyl-3-nitro-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 135241053 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 5-methyl-3-nitro-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CN1CCn2ncc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C7H8N4O3/c1-9-2-3-10-6(7(9)12)5(4-8-10)11(13)14/h4H,2-3H2,1H3 |
| InChIKey | VMYZLNKWAQOYGZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|