C11H9N3O3 — CID 118618299
6-(4-nitrophenyl)-2,3-dihydropyrazolo[5,1-b][1,3]oxazole (PubChem CID 118618299) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2,3-dihydropyrazolo[5,1-b][1,3]oxazole.
| Compound Name | 6-(4-nitrophenyl)-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 118618299 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-(4-nitrophenyl)-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3n(n2)CCO3)cc1 |
| InChI | InChI=1S/C11H9N3O3/c15-14(16)9-3-1-8(2-4-9)10-7-11-13(12-10)5-6-17-11/h1-4,7H,5-6H2 |
| InChIKey | IEFJBRUOWMRXNG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|