C20H21NO5 — CID 71739247
methyl (2R,3R)-7-methoxy-2-(4-methoxyphenyl)-5-oxo-1,2,3,4-tetrahydro-1-benzazepine-3-carboxylate (PubChem CID 71739247) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl (2R,3R)-7-methoxy-2-(4-methoxyphenyl)-5-oxo-1,2,3,4-tetrahydro-1-benzazepine-3-carboxylate.
| Compound Name | methyl (2R,3R)-7-methoxy-2-(4-methoxyphenyl)-5-oxo-1,2,3,4-tetrahydro-1-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 71739247 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl (2R,3R)-7-methoxy-2-(4-methoxyphenyl)-5-oxo-1,2,3,4-tetrahydro-1-benzazepine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)c2cc(OC)ccc2N[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H21NO5/c1-24-13-6-4-12(5-7-13)19-16(20(23)26-3)11-18(22)15-10-14(25-2)8-9-17(15)21-19/h4-10,16,19,21H,11H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | VVXZWCWSFLBJFN-APWZRJJASA-N |
| XLogP | 3.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|