C33H28N2O3 — CID 2267651
(6R,6aS,9R)-2-benzoyl-6-(4-methoxyphenyl)-9-phenyl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 2267651) has the molecular formula C33H28N2O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is (6R,6aS,9R)-2-benzoyl-6-(4-methoxyphenyl)-9-phenyl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aS,9R)-2-benzoyl-6-(4-methoxyphenyl)-9-phenyl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2267651 |
| Molecular Formula | C33H28N2O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (6R,6aS,9R)-2-benzoyl-6-(4-methoxyphenyl)-9-phenyl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@@H]2Nc3ccc(C(=O)c4ccccc4)cc3NC3=C[C@H](c4ccccc4)CC(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C33H28N2O3/c1-38-26-15-12-22(13-16-26)32-31-29(19-25(20-30(31)36)21-8-4-2-5-9-21)34-28-18-24(14-17-27(28)35-32)33(37)23-10-6-3-7-11-23/h2-19,25,31-32,34-35H,20H2,1H3/t25-,31-,32-/m0/s1 |
| InChIKey | STJAZKBGUDLDPL-OATBXSGESA-N |
| XLogP | 6.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |