C9H10N2OS — CID 84773181
7-methoxy-3,4-dihydro-1H-quinazoline-2-thione (PubChem CID 84773181) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-1H-quinazoline-2-thione.
| Compound Name | 7-methoxy-3,4-dihydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 84773181 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 7-methoxy-3,4-dihydro-1H-quinazoline-2-thione |
| SMILES | COc1ccc2c(c1)NC(=S)NC2 |
| InChI | InChI=1S/C9H10N2OS/c1-12-7-3-2-6-5-10-9(13)11-8(6)4-7/h2-4H,5H2,1H3,(H2,10,11,13) |
| InChIKey | LPHYEJDGACNHJN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|