C9H9NO3S — CID 105356975
7-methoxy-1-oxo-4H-1λ4,4-benzothiazin-3-one (PubChem CID 105356975) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is 7-methoxy-1-oxo-4H-1λ4,4-benzothiazin-3-one.
| Compound Name | 7-methoxy-1-oxo-4H-1λ4,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 105356975 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 7-methoxy-1-oxo-4H-1λ4,4-benzothiazin-3-one |
| SMILES | COc1ccc2c(c1)S(=O)CC(=O)N2 |
| InChI | InChI=1S/C9H9NO3S/c1-13-6-2-3-7-8(4-6)14(12)5-9(11)10-7/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | IJXFNOXZCXUFJO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |