C11H11NO2 — CID 143221303
7-methoxy-2,3-dihydroisoquinoline-1-carbaldehyde (PubChem CID 143221303) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 7-methoxy-2,3-dihydroisoquinoline-1-carbaldehyde.
| Compound Name | 7-methoxy-2,3-dihydroisoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 143221303 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 7-methoxy-2,3-dihydroisoquinoline-1-carbaldehyde |
| SMILES | COc1ccc2c(c1)=C(C=O)NCC=2 |
| InChI | InChI=1S/C11H11NO2/c1-14-9-3-2-8-4-5-12-11(7-13)10(8)6-9/h2-4,6-7,12H,5H2,1H3 |
| InChIKey | FTLIWZGCCKNMAO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|