C21H19NO3 — CID 122641936
1-methyl-9-phenylmethoxy-6,7-dihydrobenzo[a]quinolizine-2,4-dione (PubChem CID 122641936) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-methyl-9-phenylmethoxy-6,7-dihydrobenzo[a]quinolizine-2,4-dione.
| Compound Name | 1-methyl-9-phenylmethoxy-6,7-dihydrobenzo[a]quinolizine-2,4-dione |
|---|---|
| PubChem CID | 122641936 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-methyl-9-phenylmethoxy-6,7-dihydrobenzo[a]quinolizine-2,4-dione |
| SMILES | CC1=C2c3ccc(OCc4ccccc4)cc3CCN2C(=O)CC1=O |
| InChI | InChI=1S/C21H19NO3/c1-14-19(23)12-20(24)22-10-9-16-11-17(7-8-18(16)21(14)22)25-13-15-5-3-2-4-6-15/h2-8,11H,9-10,12-13H2,1H3 |
| InChIKey | CSIVQSHCWKFVDK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|