C20H20O4 — CID 68909509
(2Z)-2-ethoxy-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetic acid (PubChem CID 68909509) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2Z)-2-ethoxy-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetic acid.
| Compound Name | (2Z)-2-ethoxy-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 68909509 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2Z)-2-ethoxy-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetic acid |
| SMILES | CCO/C(C(=O)O)=C1/CCc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H20O4/c1-2-23-19(20(21)22)18-10-8-15-12-16(9-11-17(15)18)24-13-14-6-4-3-5-7-14/h3-7,9,11-12H,2,8,10,13H2,1H3,(H,21,22)/b19-18- |
| InChIKey | LOZRNFSNJIOXBY-HNENSFHCSA-N |
| XLogP | 4.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|