C18H15O3- — CID 23111685
(2E)-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetate (PubChem CID 23111685) has the molecular formula C18H15O3- and a molecular weight of 279.31 g/mol. Its IUPAC name is (2E)-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetate.
| Compound Name | (2E)-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetate |
|---|---|
| PubChem CID | 23111685 |
| Molecular Formula | C18H15O3- |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2E)-2-(5-phenylmethoxy-2,3-dihydroinden-1-ylidene)acetate |
| SMILES | O=C([O-])/C=C1\CCc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H16O3/c19-18(20)11-15-7-6-14-10-16(8-9-17(14)15)21-12-13-4-2-1-3-5-13/h1-5,8-11H,6-7,12H2,(H,19,20)/p-1/b15-11+ |
| InChIKey | ZOZNCURPDHERFV-RVDMUPIBSA-M |
| XLogP | 2.35 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|